What is the molecular formula of 11H-Benzo[a]carbazole?
The molecular formula of 11H-Benzo[a]carbazole is C16H11N.
What is the molecular weight of 11H-Benzo[a]carbazole?
The molecular weight of 11H-Benzo[a]carbazole is 217.26 g/mol.
What is the IUPAC name of 11H-Benzo[a]carbazole?
The IUPAC name of 11H-Benzo[a]carbazole is 11H-benzo[a]carbazole.
What is the InChI of 11H-Benzo[a]carbazole?
The InChI of 11H-Benzo[a]carbazole is InChI=1S/C16H11N/c1-2-6-12-11(5-1)9-10-14-13-7-3-4-8-15(13)17-16(12)14/h1-10,17H.
What is the InChIKey of 11H-Benzo[a]carbazole?
The InChIKey of 11H-Benzo[a]carbazole is MYKQKWIPLZEVOW-UHFFFAOYSA-N.
What is the canonical SMILES of 11H-Benzo[a]carbazole?
The canonical SMILES of 11H-Benzo[a]carbazole is C1=CC=C2C(=C1)C=CC3=C2NC4=CC=CC=C34.
What is the CAS number of 11H-Benzo[a]carbazole?
The CAS number of 11H-Benzo[a]carbazole is 239-01-0.
What is the European Community (EC) number of 11H-Benzo[a]carbazole?
The European Community (EC) number of 11H-Benzo[a]carbazole is 205-945-4.
What is the UNII of 11H-Benzo[a]carbazole?
The UNII of 11H-Benzo[a]carbazole is 3Y3SPE26QX.
What is the ChEMBL ID of 11H-Benzo[a]carbazole?
The ChEMBL ID of 11H-Benzo[a]carbazole is CHEMBL1173622.