What is the molecular formula of Oralith Brilliant Pink R?
The molecular formula of Oralith Brilliant Pink R is C18H10Cl2O2S2.
What is the molecular weight of Oralith Brilliant Pink R?
The molecular weight of Oralith Brilliant Pink R is 393.3 g/mol.
What is the IUPAC name of Oralith Brilliant Pink R?
The IUPAC name of Oralith Brilliant Pink R is (2E)-6-chloro-2-(6-chloro-4-methyl-3-oxo-1-benzothiophen-2-ylidene)-4-methyl-1-benzothiophen-3-one.
What is the InChIKey of Oralith Brilliant Pink R?
The InChIKey of Oralith Brilliant Pink R is NDDLLTAIKYHPOD-ISLYRVAYSA-N.
What is the canonical SMILES of Oralith Brilliant Pink R?
The canonical SMILES of Oralith Brilliant Pink R is CC1=CC(=CC2=C1C(=O)C(=C3C(=O)C4=C(S3)C=C(C=C4C)Cl)S2)Cl.
What is the CAS number of Oralith Brilliant Pink R?
The CAS number of Oralith Brilliant Pink R is 2379-74-0.
What is the XLogP3-AA value of Oralith Brilliant Pink R?
The XLogP3-AA value of Oralith Brilliant Pink R is 6.1.
How many hydrogen bond acceptors does Oralith Brilliant Pink R have?
Oralith Brilliant Pink R has 4 hydrogen bond acceptors.
What is the topological polar surface area of Oralith Brilliant Pink R?
The topological polar surface area of Oralith Brilliant Pink R is 84.7 Ų.
What is the complexity value of Oralith Brilliant Pink R?
The complexity value of Oralith Brilliant Pink R is 568.