What is the molecular formula of 4-Bromo-2,6-xylenol?
The molecular formula of 4-Bromo-2,6-xylenol is C8H9BrO.
What are the synonyms of 4-Bromo-2,6-xylenol?
The synonyms of 4-Bromo-2,6-xylenol include 4-Bromo-2,6-dimethylphenol, 2374-05-2, Phenol, 4-bromo-2,6-dimethyl-, and 2,6-dimethyl-4-bromophenol.
What is the molecular weight of 4-Bromo-2,6-xylenol?
The molecular weight of 4-Bromo-2,6-xylenol is 201.06 g/mol.
What is the IUPAC name of 4-Bromo-2,6-xylenol?
The IUPAC name of 4-Bromo-2,6-xylenol is 4-bromo-2,6-dimethylphenol.
What is the InChI of 4-Bromo-2,6-xylenol?
The InChI of 4-Bromo-2,6-xylenol is InChI=1S/C8H9BrO/c1-5-3-7(9)4-6(2)8(5)10/h3-4,10H,1-2H3.
What is the InChIKey of 4-Bromo-2,6-xylenol?
The InChIKey of 4-Bromo-2,6-xylenol is ZLVFYUORUHNMBO-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Bromo-2,6-xylenol?
The canonical SMILES of 4-Bromo-2,6-xylenol is CC1=CC(=CC(=C1O)C)Br.
What is the CAS number of 4-Bromo-2,6-xylenol?
The CAS number of 4-Bromo-2,6-xylenol is 2374-05-2.
What is the XLogP3 value of 4-Bromo-2,6-xylenol?
The XLogP3 value of 4-Bromo-2,6-xylenol is 2.
What is the topological polar surface area of 4-Bromo-2,6-xylenol?
The topological polar surface area of 4-Bromo-2,6-xylenol is 20.2Ų.