What is the molecular formula of 4-Bromo-3-nitropyridine?
The molecular formula of 4-Bromo-3-nitropyridine is C5H3BrN2O2.
What is the molecular weight of 4-Bromo-3-nitropyridine?
The molecular weight of 4-Bromo-3-nitropyridine is 202.99 g/mol.
What is the IUPAC name of 4-Bromo-3-nitropyridine?
The IUPAC name of 4-Bromo-3-nitropyridine is 4-bromo-3-nitropyridine.
What is the InChI of 4-Bromo-3-nitropyridine?
The InChI of 4-Bromo-3-nitropyridine is InChI=1S/C5H3BrN2O2/c6-4-1-2-7-3-5(4)8(9)10/h1-3H.
What is the InChIKey of 4-Bromo-3-nitropyridine?
The InChIKey of 4-Bromo-3-nitropyridine is KVZNAGBWCCVHKG-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Bromo-3-nitropyridine?
The canonical SMILES of 4-Bromo-3-nitropyridine is C1=CN=CC(=C1Br)[N+](=O)[O-].
What is the CAS number of 4-Bromo-3-nitropyridine?
The CAS number of 4-Bromo-3-nitropyridine is 23056-44-2.
What is the XLogP3-AA value of 4-Bromo-3-nitropyridine?
The XLogP3-AA value of 4-Bromo-3-nitropyridine is 1.4.
How many hydrogen bond donor counts does 4-Bromo-3-nitropyridine have?
4-Bromo-3-nitropyridine has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 4-Bromo-3-nitropyridine have?
4-Bromo-3-nitropyridine has 3 hydrogen bond acceptor counts.
Download
