What is the molecular formula of 2-Chloro-4-fluoroanisole?
The molecular formula of 2-Chloro-4-fluoroanisole is C7H6ClFO.
What is the molecular weight of 2-Chloro-4-fluoroanisole?
The molecular weight of 2-Chloro-4-fluoroanisole is 160.57 g/mol.
When was 2-Chloro-4-fluoroanisole created?
2-Chloro-4-fluoroanisole was created on July 19, 2005.
When was 2-Chloro-4-fluoroanisole last modified?
The last modification of 2-Chloro-4-fluoroanisole was on November 25, 2023.
What is the IUPAC name of 2-Chloro-4-fluoroanisole?
The IUPAC name of 2-Chloro-4-fluoroanisole is 2-chloro-4-fluoro-1-methoxybenzene.
What is the InChI of 2-Chloro-4-fluoroanisole?
The InChI of 2-Chloro-4-fluoroanisole is InChI=1S/C7H6ClFO/c1-10-7-3-2-5(9)4-6(7)8/h2-4H,1H3.
What is the InChIKey of 2-Chloro-4-fluoroanisole?
The InChIKey of 2-Chloro-4-fluoroanisole is RKCGJVGMRPKPNY-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Chloro-4-fluoroanisole?
The canonical SMILES of 2-Chloro-4-fluoroanisole is COC1=C(C=C(C=C1)F)Cl.
What is the CAS number of 2-Chloro-4-fluoroanisole?
The CAS number of 2-Chloro-4-fluoroanisole is 2267-25-6.
How many hydrogen bond acceptor counts does 2-Chloro-4-fluoroanisole have?
2-Chloro-4-fluoroanisole has 2 hydrogen bond acceptor counts.