What is the molecular formula of 4,4-Difluorocyclohexanol?
The molecular formula of 4,4-Difluorocyclohexanol is C6H10F2O.
What is the molecular weight of 4,4-Difluorocyclohexanol?
The molecular weight of 4,4-Difluorocyclohexanol is 136.14 g/mol.
What is the IUPAC name of 4,4-Difluorocyclohexanol?
The IUPAC name of 4,4-Difluorocyclohexanol is 4,4-difluorocyclohexan-1-ol.
What is the InChI of 4,4-Difluorocyclohexanol?
The InChI of 4,4-Difluorocyclohexanol is InChI=1S/C6H10F2O/c7-6(8)3-1-5(9)2-4-6/h5,9H,1-4H2.
What is the InChIKey of 4,4-Difluorocyclohexanol?
The InChIKey of 4,4-Difluorocyclohexanol is XTJZBCBHCPQASK-UHFFFAOYSA-N.
What is the canonical SMILES of 4,4-Difluorocyclohexanol?
The canonical SMILES of 4,4-Difluorocyclohexanol is C1CC(CCC1O)(F)F.
What is the CAS number of 4,4-Difluorocyclohexanol?
The CAS number of 4,4-Difluorocyclohexanol is 22419-35-8.
What is the European Community (EC) number of 4,4-Difluorocyclohexanol?
The European Community (EC) number of 4,4-Difluorocyclohexanol is 692-689-5.
What is the XLogP3-AA value of 4,4-Difluorocyclohexanol?
The XLogP3-AA value of 4,4-Difluorocyclohexanol is 1.5.
Is 4,4-Difluorocyclohexanol a canonicalized compound?
Yes, 4,4-Difluorocyclohexanol is a canonicalized compound according to PubChem.