What is the molecular formula of 4-Fluorothiobenzamide?
The molecular formula of 4-Fluorothiobenzamide is C7H6FNS.
What is the molecular weight of 4-Fluorothiobenzamide?
The molecular weight of 4-Fluorothiobenzamide is 155.19 g/mol.
When was 4-Fluorothiobenzamide created and modified?
4-Fluorothiobenzamide was created on July 8, 2005, and last modified on December 23, 2023.
What is the IUPAC name of 4-Fluorothiobenzamide?
The IUPAC name of 4-Fluorothiobenzamide is 4-fluorobenzenecarbothioamide.
What is the InChI of 4-Fluorothiobenzamide?
The InChI of 4-Fluorothiobenzamide is InChI=1S/C7H6FNS/c8-6-3-1-5(2-4-6)7(9)10/h1-4H,(H2,9,10).
What is the InChIKey of 4-Fluorothiobenzamide?
The InChIKey of 4-Fluorothiobenzamide is VQFOHZWOKJQOGO-UHFFFAOYSA-N.
What is the CAS number of 4-Fluorothiobenzamide?
The CAS number of 4-Fluorothiobenzamide is 22179-72-2.
What is the European Community (EC) number of 4-Fluorothiobenzamide?
The European Community (EC) number of 4-Fluorothiobenzamide is 244-820-9.
What is the XLogP3 value of 4-Fluorothiobenzamide?
The XLogP3 value of 4-Fluorothiobenzamide is 1.9.
Is 4-Fluorothiobenzamide a canonical compound?
Yes, 4-Fluorothiobenzamide is a canonical compound.