What is the IUPAC name of the compound 6,6-Dimethylfulvene?
The IUPAC name of 6,6-Dimethylfulvene is 5-propan-2-ylidenecyclopenta-1,3-diene.
What is the molecular formula of 6,6-Dimethylfulvene?
The molecular formula of 6,6-Dimethylfulvene is C8H10.
What is the molecular weight of 6,6-Dimethylfulvene?
The molecular weight of 6,6-Dimethylfulvene is 106.16 g/mol.
What is the InChI of 6,6-Dimethylfulvene?
The InChI of 6,6-Dimethylfulvene is InChI=1S/C8H10/c1-7(2)8-5-3-4-6-8/h3-6H,1-2H3.
What is the InChIKey of 6,6-Dimethylfulvene?
The InChIKey of 6,6-Dimethylfulvene is WXACXMWYHXOSIX-UHFFFAOYSA-N.
What are the other synonyms of 6,6-Dimethylfulvene?
Some other synonyms of 6,6-Dimethylfulvene include 2175-91-9, 5-(propan-2-ylidene)cyclopenta-1,3-diene, and 5-propan-2-ylidenecyclopenta-1,3-diene.
What is the XLogP3-AA value of 6,6-Dimethylfulvene?
The XLogP3-AA value of 6,6-Dimethylfulvene is 2.8.
How many hydrogen bond donor counts are there in 6,6-Dimethylfulvene?
There are 0 hydrogen bond donor counts in 6,6-Dimethylfulvene.
How many rotatable bond counts are there in 6,6-Dimethylfulvene?
There are 0 rotatable bond counts in 6,6-Dimethylfulvene.
Is 6,6-Dimethylfulvene a covalently-bonded unit?
Yes, 6,6-Dimethylfulvene is a covalently-bonded unit.