What is the molecular formula of 2,4-dibromoanisole?
The molecular formula of 2,4-dibromoanisole is C7H6Br2O.
What is the molecular weight of 2,4-dibromoanisole?
The molecular weight of 2,4-dibromoanisole is 265.93 g/mol.
What is the CAS number of 2,4-dibromoanisole?
The CAS number of 2,4-dibromoanisole is 21702-84-1.
What is the InChI of 2,4-dibromoanisole?
The InChI of 2,4-dibromoanisole is InChI=1S/C7H6Br2O/c1-10-7-3-2-5(8)4-6(7)9/h2-4H,1H3.
What is the Canonical SMILES of 2,4-dibromoanisole?
The Canonical SMILES of 2,4-dibromoanisole is COC1=C(C=C(C=C1)Br)Br.
What is the XLogP3 value of 2,4-dibromoanisole?
The XLogP3 value of 2,4-dibromoanisole is 3.6.
How many hydrogen bond donor atoms are there in 2,4-dibromoanisole?
There are 0 hydrogen bond donor atoms in 2,4-dibromoanisole.
How many hydrogen bond acceptor atoms are there in 2,4-dibromoanisole?
There is 1 hydrogen bond acceptor atom in 2,4-dibromoanisole.
How many rotatable bonds are there in 2,4-dibromoanisole?
There is 1 rotatable bond in 2,4-dibromoanisole.
What is the topological polar surface area of 2,4-dibromoanisole?
The topological polar surface area of 2,4-dibromoanisole is 9.2Ų.