What is the molecular formula of 4-Hexylbenzoic acid?
The molecular formula of 4-Hexylbenzoic acid is C13H18O2.
What is the molecular weight of 4-Hexylbenzoic acid?
The molecular weight of 4-Hexylbenzoic acid is 206.28 g/mol.
What is the IUPAC name of 4-Hexylbenzoic acid?
The IUPAC name of 4-Hexylbenzoic acid is 4-hexylbenzoic acid.
What is the InChI key of 4-Hexylbenzoic acid?
The InChI key of 4-Hexylbenzoic acid is CPEPWESLFZVUEP-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Hexylbenzoic acid?
The canonical SMILES of 4-Hexylbenzoic acid is CCCCCCC1=CC=C(C=C1)C(=O)O.
What is the CAS number of 4-Hexylbenzoic acid?
The CAS number of 4-Hexylbenzoic acid is 21643-38-9.
What is the European Community (EC) number of 4-Hexylbenzoic acid?
The European Community (EC) number of 4-Hexylbenzoic acid is 244-490-6.
What is the UNII of 4-Hexylbenzoic acid?
The UNII of 4-Hexylbenzoic acid is VF567YY01P.
What is the DSSTox Substance ID of 4-Hexylbenzoic acid?
The DSSTox Substance ID of 4-Hexylbenzoic acid is DTXSID7066720.
What is the XLogP3 value of 4-Hexylbenzoic acid?
The XLogP3 value of 4-Hexylbenzoic acid is 5.1.