What is the molecular formula of N,N-Dimethylallylamine?
The molecular formula of N,N-Dimethylallylamine is C5H11N.
What is the molecular weight of N,N-Dimethylallylamine?
The molecular weight of N,N-Dimethylallylamine is 85.15 g/mol.
What is the IUPAC name of N,N-Dimethylallylamine?
The IUPAC name of N,N-Dimethylallylamine is N,N-dimethylprop-2-en-1-amine.
What is the InChI of N,N-Dimethylallylamine?
The InChI of N,N-Dimethylallylamine is InChI=1S/C5H11N/c1-4-5-6(2)3/h4H,1,5H2,2-3H3.
What is the InChIKey of N,N-Dimethylallylamine?
The InChIKey of N,N-Dimethylallylamine is GBCKRQRXNXQQPW-UHFFFAOYSA-N.
What is the canonical SMILES of N,N-Dimethylallylamine?
The canonical SMILES of N,N-Dimethylallylamine is CN(C)CC=C.
What is the CAS number of N,N-Dimethylallylamine?
The CAS number of N,N-Dimethylallylamine is 2155-94-4.
What are the synonyms of N,N-Dimethylallylamine?
The synonyms of N,N-Dimethylallylamine are Allyldimethylamine and Dimethylallylamine.
What is the hydrogen bond donor count of N,N-Dimethylallylamine?
The hydrogen bond donor count of N,N-Dimethylallylamine is 0.
What is the hydrogen bond acceptor count of N,N-Dimethylallylamine?
The hydrogen bond acceptor count of N,N-Dimethylallylamine is 1.