What is the molecular formula of perhydroacenaphthene?
The molecular formula of perhydroacenaphthene is C12H20.
What are the synonyms of perhydroacenaphthene?
The synonyms of perhydroacenaphthene are Dodecahydroacenaphthylene and Acenaphthylene, dodecahydro-.
What is the molecular weight of perhydroacenaphthene?
The molecular weight of perhydroacenaphthene is 164.29 g/mol.
What is the IUPAC name of perhydroacenaphthene?
The IUPAC name of perhydroacenaphthene is 1,2,3,3a,4,5,5a,6,7,8,8a,8b-dodecahydroacenaphthylene.
What is the InChI of perhydroacenaphthene?
The InChI of perhydroacenaphthene is InChI=1S/C12H20/c1-3-9-4-2-6-11-8-7-10(5-1)12(9)11/h9-12H,1-8H2.
What is the InChIKey of perhydroacenaphthene?
The InChIKey of perhydroacenaphthene is FZDZWLDRELLWNN-UHFFFAOYSA-N.
What is the canonical SMILES of perhydroacenaphthene?
The canonical SMILES of perhydroacenaphthene is C1CC2CCCC3C2C(C1)CC3.
What is the CAS number of perhydroacenaphthene?
The CAS number of perhydroacenaphthene is 2146-36-3.
What is the European Community (EC) number of perhydroacenaphthene?
The European Community (EC) number of perhydroacenaphthene is 218-412-6.
What is the XLogP3-AA value of perhydroacenaphthene?
The XLogP3-AA value of perhydroacenaphthene is 4.9.