What is the molecular formula of Solvent Red 149?
The molecular formula of Solvent Red 149 is C23H22N2O2.
What is the molecular weight of Solvent Red 149?
The molecular weight of Solvent Red 149 is 358.4 g/mol.
What is the IUPAC name of Solvent Red 149?
The IUPAC name of Solvent Red 149 is 10-(cyclohexylamino)-14-methyl-14-azatetracyclo[7.7.1.0 2,7 .0 13,17 ]heptadeca-1(16),2,4,6,9,11,13(17)-heptaene-8,15-dione.
What is the InChI of Solvent Red 149?
The InChI of Solvent Red 149 is InChI=1S/C23H22N2O2/c1-25-19-12-11-18(24-14-7-3-2-4-8-14)22-21(19)17(13-20(25)26)15-9-5-6-10-16(15)23(22)27/h5-6,9-14,24H,2-4,7-8H2,1H3.
What is the InChIKey of Solvent Red 149?
The InChIKey of Solvent Red 149 is JZGUXCXDBKBCDN-UHFFFAOYSA-N.
What is the CAS number of Solvent Red 149?
The CAS number of Solvent Red 149 is 21295-57-8.
What is the European Community (EC) number of Solvent Red 149?
The European Community (EC) number of Solvent Red 149 is 244-320-0.
What is the DSSTox Substance ID of Solvent Red 149?
The DSSTox Substance ID of Solvent Red 149 is DTXSID00175560.
What is the XLogP3-AA value of Solvent Red 149?
The XLogP3-AA value of Solvent Red 149 is 4.
What is the topological polar surface area of Solvent Red 149?
The topological polar surface area of Solvent Red 149 is 49.4 ?2.