What is the molecular formula of 2-Amino-4-methoxyphenol?
The molecular formula of 2-Amino-4-methoxyphenol is C7H9NO2.
What is the molecular weight of 2-Amino-4-methoxyphenol?
The molecular weight of 2-Amino-4-methoxyphenol is 139.15 g/mol.
What is the IUPAC name of 2-Amino-4-methoxyphenol?
The IUPAC name of 2-Amino-4-methoxyphenol is 2-amino-4-methoxyphenol.
What is the InChI of 2-Amino-4-methoxyphenol?
The InChI of 2-Amino-4-methoxyphenol is InChI=1S/C7H9NO2/c1-10-5-2-3-7(9)6(8)4-5/h2-4,9H,8H2,1H3.
What is the InChIKey of 2-Amino-4-methoxyphenol?
The InChIKey of 2-Amino-4-methoxyphenol is TUADYTFWZPZZTP-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Amino-4-methoxyphenol?
The canonical SMILES of 2-Amino-4-methoxyphenol is COC1=CC(=C(C=C1)O)N.
What is the CAS number of 2-Amino-4-methoxyphenol?
The CAS number of 2-Amino-4-methoxyphenol is 20734-76-3.
What is the European Community (EC) number of 2-Amino-4-methoxyphenol?
The European Community (EC) number of 2-Amino-4-methoxyphenol is 687-284-5.
What is the ChEMBL ID of 2-Amino-4-methoxyphenol?
The ChEMBL ID of 2-Amino-4-methoxyphenol is CHEMBL1622271.
Is 2-Amino-4-methoxyphenol a canonicalized compound?
Yes, 2-Amino-4-methoxyphenol is a canonicalized compound according to PubChem.