What is the molecular formula of 2,4-Dibromo-1-naphthol?
The molecular formula of 2,4-Dibromo-1-naphthol is C10H6Br2O.
What is the molecular weight of 2,4-Dibromo-1-naphthol?
The molecular weight of 2,4-Dibromo-1-naphthol is 301.96 g/mol.
What is the IUPAC name of 2,4-Dibromo-1-naphthol?
The IUPAC name of 2,4-Dibromo-1-naphthol is 2,4-dibromonaphthalen-1-ol.
What is the InChI of 2,4-Dibromo-1-naphthol?
The InChI of 2,4-Dibromo-1-naphthol is InChI=1S/C10H6Br2O/c11-8-5-9(12)10(13)7-4-2-1-3-6(7)8/h1-5,13H.
What is the InChIKey of 2,4-Dibromo-1-naphthol?
The InChIKey of 2,4-Dibromo-1-naphthol is PSGUDVJPEWTBRM-UHFFFAOYSA-N.
What is the Canonical SMILES of 2,4-Dibromo-1-naphthol?
The Canonical SMILES of 2,4-Dibromo-1-naphthol is C1=CC=C2C(=C1)C(=CC(=C2O)Br)Br.
What is the CAS number of 2,4-Dibromo-1-naphthol?
The CAS number of 2,4-Dibromo-1-naphthol is 2050-49-9.
What is the EC number of 2,4-Dibromo-1-naphthol?
The EC number of 2,4-Dibromo-1-naphthol is 678-381-3.
What is the DSSTox Substance ID of 2,4-Dibromo-1-naphthol?
The DSSTox Substance ID of 2,4-Dibromo-1-naphthol is DTXSID80174490.
What is the Wikidata ID of 2,4-Dibromo-1-naphthol?
The Wikidata ID of 2,4-Dibromo-1-naphthol is Q72464644.