What is the molecular formula of 7H-benzo[c]carbazole?
The molecular formula of 7H-benzo[c]carbazole is C16H11N.
What is the molecular weight of 7H-benzo[c]carbazole?
The molecular weight of 7H-benzo[c]carbazole is 217.26 g/mol.
What are the synonyms of 7H-benzo[c]carbazole?
The synonyms of 7H-benzo[c]carbazole include 3,4-Benzocarbazole, 7H-Benzo(c)carbazole, and 7-Aza-7H-benzo(c)fluorene.
What is the IUPAC name of 7H-benzo[c]carbazole?
The IUPAC name of 7H-benzo[c]carbazole is 7H-benzo[c]carbazole.
What is the InChI of 7H-benzo[c]carbazole?
The InChI of 7H-benzo[c]carbazole is InChI=1S/C16H11N/c1-2-6-12-11(5-1)9-10-15-16(12)13-7-3-4-8-14(13)17-15/h1-10,17H.
What is the InChIKey of 7H-benzo[c]carbazole?
The InChIKey of 7H-benzo[c]carbazole is UGFOTZLGPPWNPY-UHFFFAOYSA-N.
What is the canonical SMILES of 7H-benzo[c]carbazole?
The canonical SMILES of 7H-benzo[c]carbazole is C1=CC=C2C(=C1)C=CC3=C2C4=CC=CC=C4N3.
What is the CAS number of 7H-benzo[c]carbazole?
The CAS number of 7H-benzo[c]carbazole is 205-25-4.
What are the other identifiers of 7H-benzo[c]carbazole?
The other identifiers of 7H-benzo[c]carbazole include European Community (EC) Number (205-909-8), NSC Number (108995), UNII (J2W3Z6C2NQ), DSSTox Substance ID (DTXSID00174477), Nikkaji Number (J193.678F), and Wikidata (Q72445366).
What is the XLogP3 value of 7H-benzo[c]carbazole?
The XLogP3 value of 7H-benzo[c]carbazole is 5.