What is the molecular formula of Diethoxymethylsilane?
The molecular formula of Diethoxymethylsilane is C5H13O2Si.
What is the molecular weight of Diethoxymethylsilane?
The molecular weight of Diethoxymethylsilane is 133.24 g/mol.
What is the InChI of Diethoxymethylsilane?
The InChI of Diethoxymethylsilane is InChI=1S/C5H13O2Si/c1-4-6-8(3)7-5-2/h4-5H2,1-3H3.
What is the InChIKey of Diethoxymethylsilane?
The InChIKey of Diethoxymethylsilane is GAURFLBIDLSLQU-UHFFFAOYSA-N.
What is the CAS number of Diethoxymethylsilane?
The CAS number of Diethoxymethylsilane is 2031-62-1.
What is the European Community Number of Diethoxymethylsilane?
The European Community Number of Diethoxymethylsilane is 217-982-3.
What is the DSSTox Substance ID of Diethoxymethylsilane?
The DSSTox Substance ID of Diethoxymethylsilane is DTXSID40893418.
What is the hydrogen bond donor count of Diethoxymethylsilane?
The hydrogen bond donor count of Diethoxymethylsilane is 0.
What is the hydrogen bond acceptor count of Diethoxymethylsilane?
The hydrogen bond acceptor count of Diethoxymethylsilane is 2.
Is Diethoxymethylsilane a canonicalized compound?
Yes, Diethoxymethylsilane is a canonicalized compound.