What is the molecular formula of Disperse Blue 77?
The molecular formula of Disperse Blue 77 is C20H12N2O6.
What is the molecular weight of Disperse Blue 77?
The molecular weight of Disperse Blue 77 is 376.3 g/mol.
What is the IUPAC name of Disperse Blue 77?
The IUPAC name of Disperse Blue 77 is 1-anilino-4,5-dihydroxy-8-nitroanthracene-9,10-dione.
What is the InChI of Disperse Blue 77?
The InChI of Disperse Blue 77 is InChI=1S/C20H12N2O6/c23-13-8-6-11(21-10-4-2-1-3-5-10)15-17(13)20(26)18-14(24)9-7-12(22(27)28)16(18)19(15)25/h1-9,21,23-24H.
What is the InChIKey of Disperse Blue 77?
The InChIKey of Disperse Blue 77 is DYALWCKAJBVSBZ-UHFFFAOYSA-N.
What is the canonical SMILES of Disperse Blue 77?
The canonical SMILES of Disperse Blue 77 is C1=CC=C(C=C1)NC2=C3C(=C(C=C2)O)C(=O)C4=C(C=CC(=C4C3=O)[N+](=O)[O-])O.
What is the CAS number of Disperse Blue 77?
The CAS number of Disperse Blue 77 is 20241-76-3.
What is the XLogP3-AA value of Disperse Blue 77?
The XLogP3-AA value of Disperse Blue 77 is 4.6.
How many hydrogen bond donor counts does Disperse Blue 77 have?
Disperse Blue 77 has 3 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does Disperse Blue 77 have?
Disperse Blue 77 has 7 hydrogen bond acceptor counts.