What is the molecular formula of Ethyl 2-(5-bromobenzofuran-3-yl)acetate?
The molecular formula of Ethyl 2-(5-bromobenzofuran-3-yl)acetate is C12H11BrO3.
What are the synonyms for Ethyl 2-(5-bromobenzofuran-3-yl)acetate?
The synonyms for Ethyl 2-(5-bromobenzofuran-3-yl)acetate are ethyl 2-(5-bromobenzofuran-3-yl)acetate, 200204-85-9, ethyl 2-(5-bromo-1-benzofuran-3-yl)acetate, MFCD09878709, Ethyl2-(5-bromobenzofuran-3-yl)acetate.
What is the molecular weight of Ethyl 2-(5-bromobenzofuran-3-yl)acetate?
The molecular weight of Ethyl 2-(5-bromobenzofuran-3-yl)acetate is 283.12 g/mol.
What is the IUPAC name of Ethyl 2-(5-bromobenzofuran-3-yl)acetate?
The IUPAC name of Ethyl 2-(5-bromobenzofuran-3-yl)acetate is ethyl 2-(5-bromo-1-benzofuran-3-yl)acetate.
What is the InChI of Ethyl 2-(5-bromobenzofuran-3-yl)acetate?
The InChI of Ethyl 2-(5-bromobenzofuran-3-yl)acetate is InChI=1S/C12H11BrO3/c1-2-15-12(14)5-8-7-16-11-4-3-9(13)6-10(8)11/h3-4,6-7H,2,5H2,1H3.
What is the InChIKey of Ethyl 2-(5-bromobenzofuran-3-yl)acetate?
The InChIKey of Ethyl 2-(5-bromobenzofuran-3-yl)acetate is NWCIURORZMAWNA-UHFFFAOYSA-N.
What is the canonical SMILES of Ethyl 2-(5-bromobenzofuran-3-yl)acetate?
The canonical SMILES of Ethyl 2-(5-bromobenzofuran-3-yl)acetate is CCOC(=O)CC1=COC2=C1C=C(C=C2)Br.
What is the CAS number of Ethyl 2-(5-bromobenzofuran-3-yl)acetate?
The CAS number of Ethyl 2-(5-bromobenzofuran-3-yl)acetate is 200204-85-9.
What is the DSSTox Substance ID of Ethyl 2-(5-bromobenzofuran-3-yl)acetate?
The DSSTox Substance ID of Ethyl 2-(5-bromobenzofuran-3-yl)acetate is DTXSID70653264.
Is Ethyl 2-(5-bromobenzofuran-3-yl)acetate a canonicalized compound?
Yes, Ethyl 2-(5-bromobenzofuran-3-yl)acetate is a canonicalized compound.
※ Please kindly note that our products are for research use only.