What is the PubChem CID for 2-Benzyloxyaniline?
The PubChem CID for 2-Benzyloxyaniline is 240548.
What is the molecular formula of 2-Benzyloxyaniline?
The molecular formula of 2-Benzyloxyaniline is C13H13NO.
What are the synonyms for 2-Benzyloxyaniline?
The synonyms for 2-Benzyloxyaniline include 2-(benzyloxy)aniline, 20012-63-9, 2-phenylmethoxyaniline, and Benzenamine, 2-(phenylmethoxy).
What is the molecular weight of 2-Benzyloxyaniline?
The molecular weight of 2-Benzyloxyaniline is 199.25 g/mol.
What is the IUPAC name of 2-Benzyloxyaniline?
The IUPAC name of 2-Benzyloxyaniline is 2-phenylmethoxyaniline.
What is the InChI of 2-Benzyloxyaniline?
The InChI of 2-Benzyloxyaniline is InChI=1S/C13H13NO/c14-12-8-4-5-9-13(12)15-10-11-6-2-1-3-7-11/h1-9H,10,14H2.
What is the InChIKey of 2-Benzyloxyaniline?
The InChIKey of 2-Benzyloxyaniline is PLPVLSBYYOWFKM-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Benzyloxyaniline?
The canonical SMILES of 2-Benzyloxyaniline is C1=CC=C(C=C1)COC2=CC=CC=C2N.
What is the CAS number of 2-Benzyloxyaniline?
The CAS number of 2-Benzyloxyaniline is 20012-63-9.
What is the molecular weight and XLogP3-AA of 2-Benzyloxyaniline?
The molecular weight of 2-Benzyloxyaniline is 199.25 g/mol and the XLogP3-AA is 2.7.