What is the molecular formula of N-Ethylisopropylamine?
The molecular formula of N-Ethylisopropylamine is C5H13N.
What is the molecular weight of N-Ethylisopropylamine?
The molecular weight of N-Ethylisopropylamine is 87.16 g/mol.
What is the IUPAC name of N-Ethylisopropylamine?
The IUPAC name of N-Ethylisopropylamine is N-ethylpropan-2-amine.
What is the InChI of N-Ethylisopropylamine?
The InChI of N-Ethylisopropylamine is InChI=1S/C5H13N/c1-4-6-5(2)3/h5-6H,4H2,1-3H3.
What is the InChIKey of N-Ethylisopropylamine?
The InChIKey of N-Ethylisopropylamine is RIVIDPPYRINTTH-UHFFFAOYSA-N.
What is the CAS number of N-Ethylisopropylamine?
The CAS number of N-Ethylisopropylamine is 19961-27-4.
What is the XLogP3 value of N-Ethylisopropylamine?
The XLogP3 value of N-Ethylisopropylamine is 0.9.
How many hydrogen bond donor counts does N-Ethylisopropylamine have?
N-Ethylisopropylamine has 1 hydrogen bond donor count.
How many rotatable bond counts does N-Ethylisopropylamine have?
N-Ethylisopropylamine has 2 rotatable bond counts.
Is N-Ethylisopropylamine a canonicalized compound?
Yes, N-Ethylisopropylamine is a canonicalized compound.