What is the molecular formula of 2-Phenylbenzyl bromide?
The molecular formula of 2-Phenylbenzyl bromide is C13H11Br.
What is the molecular weight of 2-Phenylbenzyl bromide?
The molecular weight of 2-Phenylbenzyl bromide is 247.13 g/mol.
When was 2-Phenylbenzyl bromide created?
2-Phenylbenzyl bromide was created on March 26, 2005.
When was 2-Phenylbenzyl bromide last modified?
2-Phenylbenzyl bromide was last modified on November 25, 2023.
What is the IUPAC name of 2-Phenylbenzyl bromide?
The IUPAC name of 2-Phenylbenzyl bromide is 1-(bromomethyl)-2-phenylbenzene.
What is the InChI of 2-Phenylbenzyl bromide?
The InChI of 2-Phenylbenzyl bromide is InChI=1S/C13H11Br/c14-10-12-8-4-5-9-13(12)11-6-2-1-3-7-11/h1-9H,10H2.
What is the InChIKey of 2-Phenylbenzyl bromide?
The InChIKey of 2-Phenylbenzyl bromide is SEXZHJJUKFXNDY-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Phenylbenzyl bromide?
The canonical SMILES of 2-Phenylbenzyl bromide is C1=CC=C(C=C1)C2=CC=CC=C2CBr.
What is the CAS number of 2-Phenylbenzyl bromide?
The CAS number of 2-Phenylbenzyl bromide is 19853-09-9.
What is the molecular weight of 2-Phenylbenzyl bromide according to PubChem?
The molecular weight of 2-Phenylbenzyl bromide according to PubChem is 247.13 g/mol.