What is the molecular formula of 2,3,5,6-Tetrafluorobenzaldehyde?
The molecular formula of 2,3,5,6-Tetrafluorobenzaldehyde is C7H2F4O.
What is the molecular weight of 2,3,5,6-Tetrafluorobenzaldehyde?
The molecular weight of 2,3,5,6-Tetrafluorobenzaldehyde is 178.08 g/mol.
What is the IUPAC name of 2,3,5,6-Tetrafluorobenzaldehyde?
The IUPAC name of 2,3,5,6-Tetrafluorobenzaldehyde is 2,3,5,6-tetrafluorobenzaldehyde.
What is the InChI of 2,3,5,6-Tetrafluorobenzaldehyde?
The InChI of 2,3,5,6-Tetrafluorobenzaldehyde is InChI=1S/C7H2F4O/c8-4-1-5(9)7(11)3(2-12)6(4)10/h1-2H.
What is the InChIKey of 2,3,5,6-Tetrafluorobenzaldehyde?
The InChIKey of 2,3,5,6-Tetrafluorobenzaldehyde is YIRYOMXPMOLQSO-UHFFFAOYSA-N.
What is the canonical SMILES of 2,3,5,6-Tetrafluorobenzaldehyde?
The canonical SMILES of 2,3,5,6-Tetrafluorobenzaldehyde is C1=C(C(=C(C(=C1F)F)C=O)F)F.
What is the CAS number of 2,3,5,6-Tetrafluorobenzaldehyde?
The CAS number of 2,3,5,6-Tetrafluorobenzaldehyde is 19842-76-3.
What is the EC number of 2,3,5,6-Tetrafluorobenzaldehyde?
The EC number of 2,3,5,6-Tetrafluorobenzaldehyde is 626-553-3.
What is the DSSTox Substance ID of 2,3,5,6-Tetrafluorobenzaldehyde?
The DSSTox Substance ID of 2,3,5,6-Tetrafluorobenzaldehyde is DTXSID50345039.
Is 2,3,5,6-Tetrafluorobenzaldehyde a canonicalized compound?
Yes, 2,3,5,6-Tetrafluorobenzaldehyde is a canonicalized compound.