What is the molecular formula of Pentanedioic-2,2,4,4-d4 Acid?
The molecular formula of Pentanedioic-2,2,4,4-d4 Acid is C5H8O4.
What are some synonyms of Pentanedioic-2,2,4,4-d4 Acid?
Some synonyms of Pentanedioic-2,2,4,4-d4 Acid are Glutaric acid-d4 and 2,2,4,4-Tetradeuteriopentanedioic acid.
What is the molecular weight of Pentanedioic-2,2,4,4-d4 Acid?
The molecular weight of Pentanedioic-2,2,4,4-d4 Acid is 136.14 g/mol.
When was Pentanedioic-2,2,4,4-d4 Acid created?
Pentanedioic-2,2,4,4-d4 Acid was created on December 4, 2011.
What is the IUPAC name of Pentanedioic-2,2,4,4-d4 Acid?
The IUPAC name of Pentanedioic-2,2,4,4-d4 Acid is 2,2,4,4-tetradeuteriopentanedioic acid.
What is the InChI of Pentanedioic-2,2,4,4-d4 Acid?
The InChI of Pentanedioic-2,2,4,4-d4 Acid is InChI=1S/C5H8O4/c6-4(7)2-1-3-5(8)9/h1-3H2,(H,6,7)(H,8,9)/i2D2,3D2.
What is the InChIKey of Pentanedioic-2,2,4,4-d4 Acid?
The InChIKey of Pentanedioic-2,2,4,4-d4 Acid is JFCQEDHGNNZCLN-RRVWJQJTSA-N.
What is the Canonical SMILES of Pentanedioic-2,2,4,4-d4 Acid?
The Canonical SMILES of Pentanedioic-2,2,4,4-d4 Acid is C(CC(=O)O)CC(=O)O.
How many hydrogen bond donor counts does Pentanedioic-2,2,4,4-d4 Acid have?
Pentanedioic-2,2,4,4-d4 Acid has 2 hydrogen bond donor counts.
How many rotatable bond counts does Pentanedioic-2,2,4,4-d4 Acid have?
Pentanedioic-2,2,4,4-d4 Acid has an unspecified number of rotatable bond counts.