What is the molecular formula of 3-Ethoxy-1,2-propanediol?
The molecular formula of 3-Ethoxy-1,2-propanediol is C5H12O3.
What is the molecular weight of 3-Ethoxy-1,2-propanediol?
The molecular weight of 3-Ethoxy-1,2-propanediol is 120.15 g/mol.
What is the IUPAC name of 3-Ethoxy-1,2-propanediol?
The IUPAC name of 3-Ethoxy-1,2-propanediol is 3-ethoxypropane-1,2-diol.
What is the InChI of 3-Ethoxy-1,2-propanediol?
The InChI of 3-Ethoxy-1,2-propanediol is InChI=1S/C5H12O3/c1-2-8-4-5(7)3-6/h5-7H,2-4H2,1H3.
What is the InChIKey of 3-Ethoxy-1,2-propanediol?
The InChIKey of 3-Ethoxy-1,2-propanediol is LOSWWGJGSSQDKH-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Ethoxy-1,2-propanediol?
The canonical SMILES of 3-Ethoxy-1,2-propanediol is CCOCC(CO)O.
What is the CAS number of 3-Ethoxy-1,2-propanediol?
The CAS number of 3-Ethoxy-1,2-propanediol is 1874-62-0.
What is the EC number of 3-Ethoxy-1,2-propanediol?
The EC number of 3-Ethoxy-1,2-propanediol is 217-503-8.
What is the XLogP3-AA value of 3-Ethoxy-1,2-propanediol?
The XLogP3-AA value of 3-Ethoxy-1,2-propanediol is -0.9.
Is 3-Ethoxy-1,2-propanediol a canonicalized compound?
Yes, 3-Ethoxy-1,2-propanediol is a canonicalized compound.