What is the PubChem CID of the compound?
The PubChem CID of the compound is 87583.
What is the molecular formula of the compound?
The molecular formula of the compound is C17H20O4.
What are the synonyms of the compound?
The synonyms of the compound are 4-Methylumbelliferyl heptanoate, 18319-92-1, 4-methyl-2-oxo-2h-chromen-7-yl heptanoate, (4-methyl-2-oxochromen-7-yl) heptanoate, and Heptanoic acid, 4-methyl-2-oxo-2H-1-benzopyran-7-yl ester.
What is the molecular weight of the compound?
The molecular weight of the compound is 288.34 g/mol.
When was the compound created in PubChem?
The compound was created in PubChem on July 12, 2005.
When was the compound last modified in PubChem?
The compound was last modified in PubChem on December 2, 2023.
What is the IUPAC name of the compound?
The IUPAC name of the compound is (4-methyl-2-oxochromen-7-yl) heptanoate.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C17H20O4/c1-3-4-5-6-7-16(18)20-13-8-9-14-12(2)10-17(19)21-15(14)11-13/h8-11H,3-7H2,1-2H3.
What is the InChIKey of the compound?
The InChIKey of the compound is FFNBFZWIBOIPIV-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is CCCCCCC(=O)OC1=CC2=C(C=C1)C(=CC(=O)O2)C.