What is the molecular formula of 2,4,8-Trimethylquinoline?
The molecular formula of 2,4,8-Trimethylquinoline is C12H13N.
What are the synonyms for 2,4,8-Trimethylquinoline?
The synonyms for 2,4,8-Trimethylquinoline are KEH3I9HX4R, Quinoline, 2,4,8-trimethyl-, and EINECS 242-322-6.
What is the molecular weight of 2,4,8-Trimethylquinoline?
The molecular weight of 2,4,8-Trimethylquinoline is 171.24 g/mol.
When was 2,4,8-Trimethylquinoline created?
2,4,8-Trimethylquinoline was created on March 27, 2005.
When was 2,4,8-Trimethylquinoline last modified?
2,4,8-Trimethylquinoline was last modified on October 21, 2023.
What is the IUPAC name of 2,4,8-Trimethylquinoline?
The IUPAC name of 2,4,8-Trimethylquinoline is 2,4,8-trimethylquinoline.
What is the InChI of 2,4,8-Trimethylquinoline?
The InChI of 2,4,8-Trimethylquinoline is InChI=1S/C12H13N/c1-8-5-4-6-11-9(2)7-10(3)13-12(8)11/h4-7H,1-3H3.
What is the InChIKey of 2,4,8-Trimethylquinoline?
The InChIKey of 2,4,8-Trimethylquinoline is UAPYNUQREMCVSV-UHFFFAOYSA-N.
What is the Canonical SMILES of 2,4,8-Trimethylquinoline?
The Canonical SMILES of 2,4,8-Trimethylquinoline is CC1=C2C(=CC=C1)C(=CC(=N2)C)C.
What is the CAS number of 2,4,8-Trimethylquinoline?
The CAS number of 2,4,8-Trimethylquinoline is 18441-61-7.