Potassium tetrakis(2-thienyl)borate, as a reactant, can be coupled with organic halide, alkyne or cyclohexene to obtain dienes, trienes and cyclohexene.
What is the molecular formula of Potassium tetrakis(2-thienyl)borate?
The molecular formula of Potassium tetrakis(2-thienyl)borate is C16H12BKS4.
What is the molecular weight of Potassium tetrakis(2-thienyl)borate?
It is 382.42 g/mol.
What are the storage conditions of Potassium tetrakis(2-thienyl)borate?
Potassium tetrakis(2-thienyl)borate should be stored in a cool and dry environment in a sealed way.
What is the melting point of Potassium tetrakis(2-thienyl)borate?
It is greater than 350℃.
What is the stability of Potassium tetrakis(2-thienyl)borate?
Potassium tetrakis(2-thienyl)borate is relatively stable, but to avoid contact with strong oxidants, a reaction will occur.
What the IUPAC name of Potassium tetrakis(2-thienyl)borate?
It is potassium;tetrathiophen-2-ylboranuide.
What is the EC number of Potassium tetrakis(2-thienyl)borate?
The EC number of Potassium tetrakis(2-thienyl)borate is 623-674-3.
What canonical SMILES of Potassium tetrakis(2-thienyl)borate?
It is [B-](C1=CC=CS1)(C2=CC=CS2)(C3=CC=CS3)C4=CC=CS4 [K+].
What is the main purpose of Potassium tetrakis(2-thienyl)borate?
Potassium tetrakis(2-thienyl)borate is mainly used to prepare metal complexes for catalytic reactions.
※ Please kindly note that our products are for research use only.
Download
