What is the PubChem CID for Tetrafluorophthalonitrile?
PubChem CID is 74600.
What is the molecular formula of Tetrafluorophthalonitrile?
The molecular formula is C8F4N2.
What are the synonyms for Tetrafluorophthalonitrile?
The synonyms for Tetrafluorophthalonitrile include Tetrafluorophthalonitrile, 1835-65-0, 3,4,5,6-Tetrafluorophthalonitrile, and 3,4,5,6-Tetrafluorobenzene-1,2-dicarbonitrile.
What is the molecular weight of Tetrafluorophthalonitrile?
The molecular weight is 200.09 g/mol.
When was Tetrafluorophthalonitrile created?
Tetrafluorophthalonitrile was created on March 27, 2005.
What is the IUPAC name of Tetrafluorophthalonitrile?
The IUPAC name is 3,4,5,6-tetrafluorobenzene-1,2-dicarbonitrile.
What is the InChI of Tetrafluorophthalonitrile?
The InChI is InChI=1S/C8F4N2/c9-5-3(1-13)4(2-14)6(10)8(12)7(5)11.
What is the InChIKey of Tetrafluorophthalonitrile?
The InChIKey is OFLRJMBSWDXSPG-UHFFFAOYSA-N.
What is the Canonical SMILES of Tetrafluorophthalonitrile?
The Canonical SMILES is C(#N)C1=C(C(=C(C(=C1F)F)F)F)C#N.
What is the CAS number of Tetrafluorophthalonitrile?
The CAS number is 1835-65-0.
※ Please kindly note that our products are for research use only.