What is the molecular formula of 1-Acetoxy-2-bromobenzene?
The molecular formula of 1-Acetoxy-2-bromobenzene is C8H7BrO2.
What is the molecular weight of 1-Acetoxy-2-bromobenzene?
The molecular weight of 1-Acetoxy-2-bromobenzene is 215.04 g/mol.
What is the IUPAC name of 1-Acetoxy-2-bromobenzene?
The IUPAC name of 1-Acetoxy-2-bromobenzene is (2-bromophenyl) acetate.
What is the InChI of 1-Acetoxy-2-bromobenzene?
The InChI of 1-Acetoxy-2-bromobenzene is InChI=1S/C8H7BrO2/c1-6(10)11-8-5-3-2-4-7(8)9/h2-5H,1H3.
What is the InChIKey of 1-Acetoxy-2-bromobenzene?
The InChIKey of 1-Acetoxy-2-bromobenzene is BEHBHYYPTOHUHX-UHFFFAOYSA-N.
What is the canonical SMILES of 1-Acetoxy-2-bromobenzene?
The canonical SMILES of 1-Acetoxy-2-bromobenzene is CC(=O)OC1=CC=CC=C1Br.
What is the CAS number of 1-Acetoxy-2-bromobenzene?
The CAS number of 1-Acetoxy-2-bromobenzene is 1829-37-4.
What is the European Community (EC) number of 1-Acetoxy-2-bromobenzene?
The European Community (EC) number of 1-Acetoxy-2-bromobenzene is 217-380-0.
What is the UNII of 1-Acetoxy-2-bromobenzene?
The UNII of 1-Acetoxy-2-bromobenzene is 3857W8NH83.
What is the XLogP3 value of 1-Acetoxy-2-bromobenzene?
The XLogP3 value of 1-Acetoxy-2-bromobenzene is 2.2.