What is the molecular formula of Tetraallylgermane?
The molecular formula of Tetraallylgermane is C12H20Ge.
What is the molecular weight of Tetraallylgermane?
The molecular weight of Tetraallylgermane is 236.92 g/mol.
What is the IUPAC name of Tetraallylgermane?
The IUPAC name of Tetraallylgermane is tetrakis(prop-2-enyl)germane.
What is the InChI of Tetraallylgermane?
The InChI of Tetraallylgermane is InChI=1S/C12H20Ge/c1-5-9-13(10-6-2,11-7-3)12-8-4/h5-8H,1-4,9-12H2.
What is the InChIKey of Tetraallylgermane?
The InChIKey of Tetraallylgermane is LGLLRRNQRDPDEE-UHFFFAOYSA-N.
What is the canonical SMILES of Tetraallylgermane?
The canonical SMILES of Tetraallylgermane is C=CC[Ge](CC=C)(CC=C)CC=C.
What is the CAS number of Tetraallylgermane?
The CAS number of Tetraallylgermane is 1793-91-5.
What is the European Community (EC) number of Tetraallylgermane?
The European Community (EC) number of Tetraallylgermane is 801-266-8.
What is the hydrogen bond donor count of Tetraallylgermane?
The hydrogen bond donor count of Tetraallylgermane is 0.
Is Tetraallylgermane a canonicalized compound?
Yes, Tetraallylgermane is a canonicalized compound.