What is the molecular formula of 4-(N,O-Dimethylhydroxylaminocarbonyl)phenylboronic acid?
The molecular formula is C9H12BNO4.
What are the synonyms for 4-(N,O-Dimethylhydroxylaminocarbonyl)phenylboronic acid?
The synonyms are 179055-26-6, 4-(methoxy(methyl)carbamoyl)phenylboronic acid, (4-(METHOXY(METHYL)CARBAMOYL)PHENYL)BORONIC ACID, [4-[methoxy(methyl)carbamoyl]phenyl]boronic acid.
What is the molecular weight of 4-(N,O-Dimethylhydroxylaminocarbonyl)phenylboronic acid?
The molecular weight is 209.01 g/mol.
What is the IUPAC name of 4-(N,O-Dimethylhydroxylaminocarbonyl)phenylboronic acid?
The IUPAC name is [4-[methoxy(methyl)carbamoyl]phenyl]boronic acid.
What is the InChI of 4-(N,O-Dimethylhydroxylaminocarbonyl)phenylboronic acid?
The InChI is InChI=1S/C9H12BNO4/c1-11(15-2)9(12)7-3-5-8(6-4-7)10(13)14/h3-6,13-14H,1-2H3.
What is the InChIKey of 4-(N,O-Dimethylhydroxylaminocarbonyl)phenylboronic acid?
The InChIKey is PISDDPDFGJLSQA-UHFFFAOYSA-N.
What is the canonical SMILES of 4-(N,O-Dimethylhydroxylaminocarbonyl)phenylboronic acid?
The canonical SMILES is B(C1=CC=C(C=C1)C(=O)N(C)OC)(O)O.
What is the CAS number of 4-(N,O-Dimethylhydroxylaminocarbonyl)phenylboronic acid?
The CAS number is 179055-26-6.
What is the hydrogen bond donor count of 4-(N,O-Dimethylhydroxylaminocarbonyl)phenylboronic acid?
The hydrogen bond donor count is 2.
What is the hydrogen bond acceptor count of 4-(N,O-Dimethylhydroxylaminocarbonyl)phenylboronic acid?
The hydrogen bond acceptor count is 4.
※ Please kindly note that our products are for research use only.