What is the molecular formula of 5-Chloroindole?
The molecular formula of 5-Chloroindole is C8H6ClN.
What is the molecular weight of 5-Chloroindole?
The molecular weight of 5-Chloroindole is 151.59 g/mol.
What is the IUPAC name of 5-Chloroindole?
The IUPAC name of 5-Chloroindole is 5-chloro-1H-indole.
What is the InChI of 5-Chloroindole?
The InChI of 5-Chloroindole is InChI=1S/C8H6ClN/c9-7-1-2-8-6(5-7)3-4-10-8/h1-5,10H.
What is the InChIKey of 5-Chloroindole?
The InChIKey of 5-Chloroindole is MYTGFBZJLDLWQG-UHFFFAOYSA-N.
What is the canonical SMILES of 5-Chloroindole?
The canonical SMILES of 5-Chloroindole is C1=CC2=C(C=CN2)C=C1Cl.
What is the CAS number of 5-Chloroindole?
The CAS number of 5-Chloroindole is 17422-32-1.
What is the European Community (EC) number of 5-Chloroindole?
The European Community (EC) number of 5-Chloroindole is 241-448-9.
What is the UNII of 5-Chloroindole?
The UNII of 5-Chloroindole is FMJ30GB9J6.
Is 5-Chloroindole a canonicalized compound?
Yes, 5-Chloroindole is a canonicalized compound according to PubChem.