What is the molecular formula of 4-Bromo-3-ethoxypyridine?
The molecular formula of 4-Bromo-3-ethoxypyridine is C7H8BrNO.
What is the molecular weight of 4-Bromo-3-ethoxypyridine?
The molecular weight of 4-Bromo-3-ethoxypyridine is 202.05 g/mol.
What is the IUPAC name of 4-Bromo-3-ethoxypyridine?
The IUPAC name of 4-Bromo-3-ethoxypyridine is 4-bromo-3-ethoxypyridine.
What is the InChI of 4-Bromo-3-ethoxypyridine?
The InChI of 4-Bromo-3-ethoxypyridine is InChI=1S/C7H8BrNO/c1-2-10-7-5-9-4-3-6(7)8/h3-5H,2H2,1H3.
What is the InChIKey of 4-Bromo-3-ethoxypyridine?
The InChIKey of 4-Bromo-3-ethoxypyridine is MMZIZYMZDAFOGC-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Bromo-3-ethoxypyridine?
The canonical SMILES of 4-Bromo-3-ethoxypyridine is CCOC1=C(C=CN=C1)Br.
What is the CAS number of 4-Bromo-3-ethoxypyridine?
The CAS number of 4-Bromo-3-ethoxypyridine is 17117-21-4.
What is the XLogP3-AA value of 4-Bromo-3-ethoxypyridine?
The XLogP3-AA value of 4-Bromo-3-ethoxypyridine is 1.9.
How many hydrogen bond donor counts does 4-Bromo-3-ethoxypyridine have?
4-Bromo-3-ethoxypyridine has 0 hydrogen bond donor count.
How many hydrogen bond acceptor counts does 4-Bromo-3-ethoxypyridine have?
4-Bromo-3-ethoxypyridine has 2 hydrogen bond acceptor count.