What is the molecular formula of H-Glu(H-Lys-OH)-OH?
The molecular formula is C11H21N3O5.
What are some synonyms for H-Glu(H-Lys-OH)-OH?
Some synonyms are 17105-15-6, epsilon-(gamma-Glutamyl)-lysine, epsilon-(gamma-L-Glutamyl)lysine, epsilon-(gamma-L-Glutamyl)-L-lysine.
What is the molecular weight of H-Glu(H-Lys-OH)-OH?
The molecular weight is 275.30 g/mol.
What is the chemical structure of H-Glu(H-Lys-OH)-OH?
The chemical structure can be viewed at the following link: https://pubchem.ncbi.nlm.nih.gov/image/imgsrv.fcgi?cid=7015685&t=l
What is the IUPAC name of H-Glu(H-Lys-OH)-OH?
The IUPAC name is (2S)-2-amino-6-[[(4S)-4-amino-4-carboxybutanoyl]amino]hexanoic acid.
What is the InChI of H-Glu(H-Lys-OH)-OH?
The InChI is InChI=1S/C11H21N3O5/c12-7(10(16)17)3-1-2-6-14-9(15)5-4-8(13)11(18)19/h7-8H,1-6,12-13H2,(H,14,15)(H,16,17)(H,18,19)/t7-,8-/m0/s1.
What is the InChIKey of H-Glu(H-Lys-OH)-OH?
The InChIKey is JPKNLFVGUZRHOB-YUMQZZPRSA-N.
What is the CAS number of H-Glu(H-Lys-OH)-OH?
The CAS number is 17105-15-6.
What are some computed properties of H-Glu(H-Lys-OH)-OH?
Some computed properties include the molecular weight, XLogP3-AA, hydrogen bond donor count, hydrogen bond acceptor count, rotatable bond count, exact mass, topological polar surface area, heavy atom count, formal charge, complexity, isotope atom count, defined atom stereocenter count, undefined atom stereocenter count, defined bond stereocenter count, undefined bond stereocenter count, covalently-bonded unit count, and canonicalization.
How is H-Glu(H-Lys-OH)-OH described in terms of physical description?
It is described as a solid.