What is the molecular formula of Nitrosonium hexafluoroantimonate?
The molecular formula of Nitrosonium hexafluoroantimonate is F6NOSb.
What is the molecular weight of Nitrosonium hexafluoroantimonate?
The molecular weight of Nitrosonium hexafluoroantimonate is 265.757 g/mol.
What are the synonyms of Nitrosonium hexafluoroantimonate?
The synonyms of Nitrosonium hexafluoroantimonate are Nitrosyl hexafluoroantimonate and azanylidyneoxidanium;hexafluoroantimony(1-).
When was Nitrosonium hexafluoroantimonate created and modified?
Nitrosonium hexafluoroantimonate was created on August 23, 2007, and last modified on December 2, 2023.
What is the IUPAC name of Nitrosonium hexafluoroantimonate?
The IUPAC name of Nitrosonium hexafluoroantimonate is azanylidyneoxidanium;hexafluoroantimony(1-).
What is the InChI of Nitrosonium hexafluoroantimonate?
The InChI of Nitrosonium hexafluoroantimonate is InChI=1S/6FH.NO.Sb/c;;;;;;1-2;/h6*1H;;/q;;;;;;+1;+5/p-6.
What is the InChIKey of Nitrosonium hexafluoroantimonate?
The InChIKey of Nitrosonium hexafluoroantimonate is AMGJCGWYCZRXHS-UHFFFAOYSA-H.
What is the canonical SMILES of Nitrosonium hexafluoroantimonate?
The canonical SMILES of Nitrosonium hexafluoroantimonate is N#[O+].F[Sb-](F)(F)(F)(F)F.
What is the CAS number of Nitrosonium hexafluoroantimonate?
The CAS number of Nitrosonium hexafluoroantimonate is 16941-06-3.
What is the molecular weight, hydrogen bond donor count, hydrogen bond acceptor count, rotatable bond count, exact mass, monoisotopic mass, topological polar surface area, heavy atom count, formal charge, complexity, isotope atom count, defined atom stereocenter count, undefined atom stereocenter count, defined bond stereocenter count, undefined bond stereocenter count, covalently-bonded unit count, and canonicalization of Nitrosonium hexafluoroantimonate?
The molecular weight of Nitrosonium hexafluoroantimonate is 265.757 g/mol. The hydrogen bond donor count is 0. The hydrogen bond acceptor count is 8. The rotatable bond count is 0. The exact mass is 264.89222 g/mol. The monoisotopic mass is 264.89222 g/mol. The topological polar surface area is 24.8Ų. The heavy atom count is 9. The formal charge is 0. The complexity is 72.7. The isotope atom count is 0. The defined atom stereocenter count is 0. The undefined atom stereocenter count is 0. The defined bond stereocenter count is 0. The undefined bond stereocenter count is 0. The covalently-bonded unit count is 2. The compound is canonicalized.
※ Please kindly note that our products are for research use only.