What is the molecular formula of cis-Stilbene oxide?
The molecular formula of cis-Stilbene oxide is C14H12O.
What is the molecular weight of cis-Stilbene oxide?
The molecular weight of cis-Stilbene oxide is 196.24 g/mol.
What is the IUPAC name of cis-Stilbene oxide?
The IUPAC name of cis-Stilbene oxide is (2R,3S)-2,3-diphenyloxirane.
What is the InChI of cis-Stilbene oxide?
The InChI of cis-Stilbene oxide is InChI=1S/C14H12O/c1-3-7-11(8-4-1)13-14(15-13)12-9-5-2-6-10-12/h1-10,13-14H/t13-,14+.
What is the InChIKey of cis-Stilbene oxide?
The InChIKey of cis-Stilbene oxide is ARCJQKUWGAZPFX-OKILXGFUSA-N.
What is the canonical SMILES of cis-Stilbene oxide?
The canonical SMILES of cis-Stilbene oxide is C1=CC=C(C=C1)C2C(O2)C3=CC=CC=C3.
How many hydrogen bond donor count does cis-Stilbene oxide have?
cis-Stilbene oxide has 0 hydrogen bond donor count.
How many hydrogen bond acceptor count does cis-Stilbene oxide have?
cis-Stilbene oxide has 1 hydrogen bond acceptor count.
How many rotatable bond count does cis-Stilbene oxide have?
cis-Stilbene oxide has 2 rotatable bond count.
What is the topological polar surface area of cis-Stilbene oxide?
The topological polar surface area of cis-Stilbene oxide is 12.5Ų.