What is the molecular formula of 4-Amino-2-bromophenol?
The molecular formula of 4-Amino-2-bromophenol is C6H6BrNO.
What is the molecular weight of 4-Amino-2-bromophenol?
The molecular weight of 4-Amino-2-bromophenol is 188.02 g/mol.
What is the IUPAC name of 4-Amino-2-bromophenol?
The IUPAC name of 4-Amino-2-bromophenol is 4-amino-2-bromophenol.
What is the InChI of 4-Amino-2-bromophenol?
The InChI of 4-Amino-2-bromophenol is InChI=1S/C6H6BrNO/c7-5-3-4(8)1-2-6(5)9/h1-3,9H,8H2.
What is the InChIKey of 4-Amino-2-bromophenol?
The InChIKey of 4-Amino-2-bromophenol is CBQJZWGBFZAUEV-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Amino-2-bromophenol?
The canonical SMILES of 4-Amino-2-bromophenol is C1=CC(=C(C=C1N)Br)O.
What is the CAS number of 4-Amino-2-bromophenol?
The CAS number of 4-Amino-2-bromophenol is 16750-67-7.
What is the European Community (EC) number of 4-Amino-2-bromophenol?
The European Community (EC) number of 4-Amino-2-bromophenol is 685-751-8.
What is the DSSTox Substance ID of 4-Amino-2-bromophenol?
The DSSTox Substance ID of 4-Amino-2-bromophenol is DTXSID30560309.
Is 4-Amino-2-bromophenol a canonicalized compound?
Yes, 4-Amino-2-bromophenol is a canonicalized compound.