What is the molecular formula of 1H-indole-3-carboxamide?
The molecular formula is C9H8N2O.
What are the synonyms for 1H-indole-3-carboxamide?
The synonyms are 1H-Indole-3-carboxylic acid amide and indole-3-carboxamide.
What is the molecular weight of 1H-indole-3-carboxamide?
The molecular weight is 160.17 g/mol.
When was 1H-indole-3-carboxamide created?
It was created on July 15, 2005.
Is 1H-indole-3-carboxamide a natural product?
Yes, it is a natural product found in Isatis tinctoria and Zyzzya.
What is the IUPAC name of 1H-indole-3-carboxamide?
The IUPAC name is 1H-indole-3-carboxamide.
What is the InChI of 1H-indole-3-carboxamide?
The InChI is InChI=1S/C9H8N2O/c10-9(12)7-5-11-8-4-2-1-3-6(7)8/h1-5,11H,(H2,10,12).
What is the InChIKey of 1H-indole-3-carboxamide?
The InChIKey is LSGKMZLPZFPAIN-UHFFFAOYSA-N.
What is the canonical SMILES of 1H-indole-3-carboxamide?
The canonical SMILES is C1=CC=C2C(=C1)C(=CN2)C(=O)N.
What is the CAS number of 1H-indole-3-carboxamide?
The CAS number is 1670-85-5.