What is the molecular formula of l-Stepholidine?
The molecular formula of l-Stepholidine is C19H21NO4.
What are some synonyms for l-Stepholidine?
Some synonyms for l-Stepholidine include stepholidine, (-)-Stepholidine, and (S)-3,9-Dimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[3,2-a]isoquinoline-2,10-diol.
Where is l-Stepholidine found?
l-Stepholidine is a natural product found in Desmos cochinchinensis, Meiogyne monosperma, and other organisms.
What is the molecular weight of l-Stepholidine?
The molecular weight of l-Stepholidine is 327.4 g/mol.
What is the IUPAC name of l-Stepholidine?
The IUPAC name of l-Stepholidine is (13aS)-3,9-dimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline-2,10-diol.
What is the InChI key of l-Stepholidine?
The InChI key of l-Stepholidine is JKPISQIIWUONPB-HNNXBMFYSA-N.
What is the canonical SMILES of l-Stepholidine?
The canonical SMILES of l-Stepholidine is COC1=C(C=C2C3CC4=C(CN3CCC2=C1)C(=C(C=C4)O)OC)O.
What is the CAS number of l-Stepholidine?
The CAS number of l-Stepholidine is 16562-13-3.
What is the XLogP3-AA value of l-Stepholidine?
The XLogP3-AA value of l-Stepholidine is 2.6.
Is l-Stepholidine a canonicalized compound?
Yes, l-Stepholidine is a canonicalized compound.
Download
