What is the molecular formula of 1,6-Dibromo-2-naphthol?
The molecular formula of 1,6-Dibromo-2-naphthol is C10H6Br2O.
What is the molecular weight of 1,6-Dibromo-2-naphthol?
The molecular weight of 1,6-Dibromo-2-naphthol is 301.96 g/mol.
What is the IUPAC name of 1,6-Dibromo-2-naphthol?
The IUPAC name of 1,6-Dibromo-2-naphthol is 1,6-dibromonaphthalen-2-ol.
What is the InChI of 1,6-Dibromo-2-naphthol?
The InChI of 1,6-Dibromo-2-naphthol is InChI=1S/C10H6Br2O/c11-7-2-3-8-6(5-7)1-4-9(13)10(8)12/h1-5,13H.
What is the InChIKey of 1,6-Dibromo-2-naphthol?
The InChIKey of 1,6-Dibromo-2-naphthol is VKESFYLPKHQOOA-UHFFFAOYSA-N.
What is the canonical SMILES of 1,6-Dibromo-2-naphthol?
The canonical SMILES of 1,6-Dibromo-2-naphthol is C1=CC2=C(C=CC(=C2Br)O)C=C1Br.
What is the CAS number of 1,6-Dibromo-2-naphthol?
The CAS number of 1,6-Dibromo-2-naphthol is 16239-18-2.
What is the European Community (EC) number of 1,6-Dibromo-2-naphthol?
The European Community (EC) number of 1,6-Dibromo-2-naphthol is 240-356-6.
What is the UNII of 1,6-Dibromo-2-naphthol?
The UNII of 1,6-Dibromo-2-naphthol is W9S75P5MUJ.
Is 1,6-Dibromo-2-naphthol a canonicalized compound?
Yes, 1,6-Dibromo-2-naphthol is a canonicalized compound.