What is the molecular formula of N-Boc-4-iodoaniline?
The molecular formula of N-Boc-4-iodoaniline is C11H14INO2.
What is the molecular weight of N-Boc-4-iodoaniline?
The molecular weight of N-Boc-4-iodoaniline is 319.14 g/mol.
What is the IUPAC name of N-Boc4-iodoaniline?
The IUPAC name of N-Boc-4-iodoaniline is tert-butyl N-(4-iodophenyl)carbamate.
What is the InChI of N-Boc-4-iodoaniline?
The InChI of N-Boc-4-iodoaniline is InChI=1S/C11H14INO2/c1-11(2,3)15-10(14)13-9-6-4-8(12)5-7-9/h4-7H,1-3H3,(H,13,14).
What is the InChIKey of N-Boc-4-iodoaniline?
The InChIKey of N-Boc-4-iodoaniline is CGALRQWBJFDAKN-UHFFFAOYSA-N.
What is the canonical SMILES of N-Boc-4-iodoaniline?
The canonical SMILES of N-Boc-4-iodoaniline is CC(C)(C)OC(=O)NC1=CC=C(C=C1)I.
What is the CAS number of N-Boc-4-iodoaniline?
The CAS number of N-Boc-4-iodoaniline is 159217-89-7.
What is the EC number of N-Boc-4-iodoaniline?
The EC number of N-Boc-4-iodoaniline is 671-697-2.
What is the XLogP3 value of N-Boc-4-iodoaniline?
The XLogP3 value of N-Boc-4-iodoaniline is 4.1.
Is N-Boc-4-iodoaniline a canonicalized compound?
Yes, N-Boc-4-iodoaniline is a canonicalized compound.