What is the molecular formula of 1,3-Dibromotetrafluorobenzene?
The molecular formula of 1,3-Dibromotetrafluorobenzene is C6Br2F4.
What are the synonyms of 1,3-Dibromotetrafluorobenzene?
The synonyms of 1,3-Dibromotetrafluorobenzene are 1,3-Dibromotetrafluorobenzene, 1559-87-1, 1,3-Dibromo-2,4,5,6-tetrafluorobenzene, BENZENE, 1,3-DIBROMO-2,4,5,6-TETRAFLUORO-, MFCD00031533.
What is the molecular weight of 1,3-Dibromotetrafluorobenzene?
The molecular weight of 1,3-Dibromotetrafluorobenzene is 307.87 g/mol.
When was 1,3-Dibromotetrafluorobenzene created and modified in PubChem?
1,3-Dibromotetrafluorobenzene was created on 2005-03-26 and last modified on 2023-11-25 in PubChem.
What is the IUPAC name of 1,3-Dibromotetrafluorobenzene?
The IUPAC name of 1,3-Dibromotetrafluorobenzene is 1,3-dibromo-2,4,5,6-tetrafluorobenzene.
What is the InChI of 1,3-Dibromotetrafluorobenzene?
The InChI of 1,3-Dibromotetrafluorobenzene is InChI=1S/C6Br2F4/c7-1-3(9)2(8)5(11)6(12)4(1)10.
What is the InChIKey of 1,3-Dibromotetrafluorobenzene?
The InChIKey of 1,3-Dibromotetrafluorobenzene is UCWKDDQEZQRGDR-UHFFFAOYSA-N.
What is the canonical SMILES of 1,3-Dibromotetrafluorobenzene?
The canonical SMILES of 1,3-Dibromotetrafluorobenzene is C1(=C(C(=C(C(=C1F)Br)F)Br)F)F.
What is the CAS number of 1,3-Dibromotetrafluorobenzene?
The CAS number of 1,3-Dibromotetrafluorobenzene is 1559-87-1.
Does 1,3-Dibromotetrafluorobenzene have a defined bond stereocenter count?
No, 1,3-Dibromotetrafluorobenzene does not have a defined bond stereocenter count (it is 0).