What is the molecular formula of vanadyl oxalate?
The molecular formula of vanadyl oxalate is C2H2O5V.
What are the synonyms of vanadyl oxalate?
The synonyms of vanadyl oxalate are oxalic acid;oxovanadium, Vanadium oxyoxalate, and DTXSID201287100.
What is the molecular weight of vanadyl oxalate?
The molecular weight of vanadyl oxalate is 156.98 g/mol.
What is the IUPAC name of vanadyl oxalate?
The IUPAC name of vanadyl oxalate is oxalic acid;oxovanadium.
What is the InChI of vanadyl oxalate?
The InChI of vanadyl oxalate is InChI=1S/C2H2O4.O.V/c3-1(4)2(5)6;;/h(H,3,4)(H,5,6);;.
What is the InChIKey of vanadyl oxalate?
The InChIKey of vanadyl oxalate is OGUCKKLSDGRKSH-UHFFFAOYSA-N.
What are the other identifiers of vanadyl oxalate?
The other identifiers of vanadyl oxalate include CAS number 15500-04-6, European Community (EC) Number 604-991-6, and DSSTox Substance ID DTXSID201287100.
What is the hydrogen bond donor count of vanadyl oxalate?
The hydrogen bond donor count of vanadyl oxalate is 2.
What is the hydrogen bond acceptor count of vanadyl oxalate?
The hydrogen bond acceptor count of vanadyl oxalate is 5.
Is vanadyl oxalate a covalently-bonded compound?
Yes, vanadyl oxalate is a covalently-bonded compound.
Download
