What is the molecular formula of 4,4-Bipiperidine?
The molecular formula of 4,4-Bipiperidine is C10H20N2.
What is the molecular weight of 4,4-Bipiperidine?
The molecular weight of 4,4-Bipiperidine is 168.28 g/mol.
What is the IUPAC name of 4,4-Bipiperidine?
The IUPAC name of 4,4-Bipiperidine is 4-piperidin-4-ylpiperidine.
What is the InChI of 4,4-Bipiperidine?
The InChI of 4,4-Bipiperidine is InChI=1S/C10H20N2/c1-5-11-6-2-9(1)10-3-7-12-8-4-10/h9-12H,1-8H2.
What is the InChIKey of 4,4-Bipiperidine?
The InChIKey of 4,4-Bipiperidine is PRNRUOJLUPUJDN-UHFFFAOYSA-N.
What is the canonical SMILES of 4,4-Bipiperidine?
The canonical SMILES of 4,4-Bipiperidine is C1CNCCC1C2CCNCC2.
What is the CAS number of 4,4-Bipiperidine?
The CAS number of 4,4-Bipiperidine is 15336-72-8.
What is the EC number of 4,4-Bipiperidine?
The EC number of 4,4-Bipiperidine is 683-647-7.
What is the DSSTox Substance ID of 4,4-Bipiperidine?
The DSSTox Substance ID of 4,4-Bipiperidine is DTXSID80352918.
Is 4,4-Bipiperidine a canonicalized compound?
Yes, 4,4-Bipiperidine is a canonicalized compound.