What is the molecular formula of (1-Boc-amino)adamantane?
The molecular formula is C15H25NO2.
What is the molecular weight of (1-Boc-amino)adamantane?
The molecular weight is 251.36 g/mol.
What is the IUPAC name of (1-Boc-amino)adamantane?
The IUPAC name is tert-butyl N-(1-adamantyl)carbamate.
What is the InChI of (1-Boc-amino)adamantane?
The InChI is InChI=1S/C15H25NO2/c1-14(2,3)18-13(17)16-15-7-10-4-11(8-15)6-12(5-10)9-15/h10-12H,4-9H2,1-3H3,(H,16,17)
What is the InChIKey of (1-Boc-amino)adamantane?
The InChIKey is LSVGBVIPHLXQPG-UHFFFAOYSA-N.
What is the canonical SMILES of (1-Boc-amino)adamantane?
The canonical SMILES is CC(C)(C)OC(=O)NC12CC3CC(C1)CC(C3)C2.
What is the CAS number of (1-Boc-amino)adamantane?
The CAS number is 151476-40-3.
What is the European Community (EC) number of (1-Boc-amino)adamantane?
The EC number is 685-747-6.
What is the DSSTox Substance ID of (1-Boc-amino)adamantane?
The DSSTox Substance ID is DTXSID60401099.
What is the topological polar surface area of (1-Boc-amino)adamantane?
The topological polar surface area is 38.3Ų.