What is the PubChem CID of Cyclohexylsuccinic acid?
PubChem CID 567920.
What is the molecular formula of Cyclohexylsuccinic acid?
The molecular formula is C10H16O4.
What is the molecular weight of Cyclohexylsuccinic acid?
The molecular weight is 200.23 g/mol.
What is the IUPAC name of Cyclohexylsuccinic acid?
The IUPAC name is 2-cyclohexylbutanedioic acid.
What is the InChI of Cyclohexylsuccinic acid?
The InChI is InChI=1S/C10H16O4/c11-9(12)6-8(10(13)14)7-4-2-1-3-5-7/h7-8H,1-6H2,(H,11,12)(H,13,14).
What is the InChIKey of Cyclohexylsuccinic acid?
The InChIKey is FROUMWCGMNOSBK-UHFFFAOYSA-N.
What is the canonical SMILES of Cyclohexylsuccinic acid?
The canonical SMILES is C1CCC(CC1)C(CC(=O)O)C(=O)O.
What is the CAS number of Cyclohexylsuccinic acid?
The CAS number is 1489-63-0.
What is the EC number of Cyclohexylsuccinic acid?
The EC number is 624-940-1.
Is Cyclohexylsuccinic acid a canonicalized compound according to PubChem?
Yes, Cyclohexylsuccinic acid is a canonicalized compound according to PubChem.
Download
