What is the molecular formula of 2,5-Dibromohydroquinone?
The molecular formula of 2,5-Dibromohydroquinone is C6H4Br2O2.
What is the molecular weight of 2,5-Dibromohydroquinone?
The molecular weight of 2,5-Dibromohydroquinone is 267.90 g/mol.
What is the IUPAC Name of 2,5-Dibromohydroquinone?
The IUPAC name of 2,5-Dibromohydroquinone is 2,5-dibromobenzene-1,4-diol.
What is the InChI of 2,5-Dibromohydroquinone?
The InChI of 2,5-Dibromohydroquinone is InChI=1S/C6H4Br2O2/c7-3-1-5(9)4(8)2-6(3)10/h1-2,9-10H.
What is the InChIKey of 2,5-Dibromohydroquinone?
The InChIKey of 2,5-Dibromohydroquinone is VALXCIRMSIFPFN-UHFFFAOYSA-N.
What is the canonical SMILES of 2,5-Dibromohydroquinone?
The canonical SMILES of 2,5-Dibromohydroquinone is C1=C(C(=CC(=C1Br)O)Br)O.
What is the CAS number of 2,5-Dibromohydroquinone?
The CAS number of 2,5-Dibromohydroquinone is 14753-51-6.
What is the European Community (EC) Number of 2,5-Dibromohydroquinone?
The European Community (EC) Number of 2,5-Dibromohydroquinone is 629-317-8.
What is the DSSTox Substance ID of 2,5-Dibromohydroquinone?
The DSSTox Substance ID of 2,5-Dibromohydroquinone is DTXSID90299865.
Is 2,5-Dibromohydroquinone a canonicalized compound?
Yes, 2,5-Dibromohydroquinone is a canonicalized compound according to PubChem.