What is the molecular formula of Ethyl 2,3-butadienoate?
The molecular formula of Ethyl 2,3-butadienoate is C6H8O2.
What is the molecular weight of Ethyl 2,3-butadienoate?
The molecular weight of Ethyl 2,3-butadienoate is 112.13 g/mol.
What is the InChI of Ethyl 2,3-butadienoate?
The InChI of Ethyl 2,3-butadienoate is InChI=1S/C6H8O2/c1-3-5-6(7)8-4-2/h5H,1,4H2,2H3.
What is the InChIKey of Ethyl 2,3-butadienoate?
The InChIKey of Ethyl 2,3-butadienoate is GLSUOACRAMLJIW-UHFFFAOYSA-N.
What is the Canonical SMILES of Ethyl 2,3-butadienoate?
The Canonical SMILES of Ethyl 2,3-butadienoate is CCOC(=O)C=C=C.
What is the CAS number of Ethyl 2,3-butadienoate?
The CAS number of Ethyl 2,3-butadienoate is 14369-81-4.
What is the EC number of Ethyl 2,3-butadienoate?
The EC number of Ethyl 2,3-butadienoate is 627-301-5.
What is the XLogP3-AA value of Ethyl 2,3-butadienoate?
The XLogP3-AA value of Ethyl 2,3-butadienoate is 0.7.
What is the hydrogen bond donor count of Ethyl 2,3-butadienoate?
The hydrogen bond donor count of Ethyl 2,3-butadienoate is 0.
What is the hydrogen bond acceptor count of Ethyl 2,3-butadienoate?
The hydrogen bond acceptor count of Ethyl 2,3-butadienoate is 2.