What is the molecular formula of Manganese phthalocyanine?
The molecular formula of Manganese phthalocyanine is C32H16MnN8.
What are the synonyms for Manganese phthalocyanine?
The synonyms for Manganese phthalocyanine include mn(pc), MFCD00049821, F87462, and 2,11,20,29,37,39-hexaza-38,40-diazanidanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetraconta-1,3,5,7,9,11,13,15,17,19(39),20,22,24,26,28,30(37),31,33,35-nonadecaene;manganese(2+).
What is the molecular weight of Manganese phthalocyanine?
The molecular weight of Manganese phthalocyanine is 567.5 g/mol.
What is the parent compound of Manganese phthalocyanine?
The parent compound of Manganese phthalocyanine is Phthalocyanine (CID 86280045).
What are the component compounds of Manganese phthalocyanine?
The component compounds of Manganese phthalocyanine include Phthalocyanine (CID 86280045), Manganese (CID 23930), and 31h-Phthalocyanine (CID 5282330).
When was Manganese phthalocyanine created and modified in PubChem?
Manganese phthalocyanine was created on July 19, 2005, and last modified on December 2, 2023.
What is the IUPAC name of Manganese phthalocyanine?
The IUPAC name of Manganese phthalocyanine is 2,11,20,29,37,39-hexaza-38,40-diazanidanonacyclo[28.6.1.1 3,10 .1 12,19 .1 21,28 .0 4,9 .0 13,18 .0 22,27 .0 31,36 ]tetraconta-1,3,5,7,9,11,13,15,17,19(39),20,22,24,26,28,30(37),31,33,35-nonadecaene;manganese(2+).
What is the InChI of Manganese phthalocyanine?
The InChI of Manganese phthalocyanine is InChI=1S/C32H16N8.Mn/c1-2-10-18-17(9-1)25-33-26(18)38-28-21-13-5-6-14-22(21)30(35-28)40-32-24-16-8-7-15-23(24)31(36-32)39-29-20-12-4-3-11-19(20)27(34-29)37-25;/h1-16H;/q-2;+2.
What is the InChIKey of Manganese phthalocyanine?
The InChIKey of Manganese phthalocyanine is ICIFYHOILPYQKB-UHFFFAOYSA-N.
What is the CAS number of Manganese phthalocyanine?
The CAS number of Manganese phthalocyanine is 14325-24-7.